C20H29F3N2O3 — CID 153346242
1-tert-butyl-2-methyl-6-(trifluoromethoxy)benzimidazole;5-hydroxy-5-methylhexan-3-one (PubChem CID 153346242) has the molecular formula C20H29F3N2O3 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-tert-butyl-2-methyl-6-(trifluoromethoxy)benzimidazole;5-hydroxy-5-methylhexan-3-one.
| Compound Name | 1-tert-butyl-2-methyl-6-(trifluoromethoxy)benzimidazole;5-hydroxy-5-methylhexan-3-one |
|---|---|
| PubChem CID | 153346242 |
| Molecular Formula | C20H29F3N2O3 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-tert-butyl-2-methyl-6-(trifluoromethoxy)benzimidazole;5-hydroxy-5-methylhexan-3-one |
| SMILES | CCC(=O)CC(C)(C)O.Cc1nc2ccc(OC(F)(F)F)cc2n1C(C)(C)C |
| InChI | InChI=1S/C13H15F3N2O.C7H14O2/c1-8-17-10-6-5-9(19-13(14,15)16)7-11(10)18(8)12(2,3)4;1-4-6(8)5-7(2,3)9/h5-7H,1-4H3;9H,4-5H2,1-3H3 |
| InChIKey | FSLBLBHYMSEYLW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |