C10H21N3O3S — CID 153346647
N-[2-[3-aminopropyl(hydroxy)amino]ethyl]-2-(2-oxopropylsulfanyl)acetamide (PubChem CID 153346647) has the molecular formula C10H21N3O3S and a molecular weight of 263.36 g/mol. Its IUPAC name is N-[2-[3-aminopropyl(hydroxy)amino]ethyl]-2-(2-oxopropylsulfanyl)acetamide.
| Compound Name | N-[2-[3-aminopropyl(hydroxy)amino]ethyl]-2-(2-oxopropylsulfanyl)acetamide |
|---|---|
| PubChem CID | 153346647 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[2-[3-aminopropyl(hydroxy)amino]ethyl]-2-(2-oxopropylsulfanyl)acetamide |
| SMILES | CC(=O)CSCC(=O)NCCN(O)CCCN |
| InChI | InChI=1S/C10H21N3O3S/c1-9(14)7-17-8-10(15)12-4-6-13(16)5-2-3-11/h16H,2-8,11H2,1H3,(H,12,15) |
| InChIKey | OGWLHCXOFOOBEQ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|