C28H42FN6O3+3 — CID 153347064
5-[[18-ethenyl-12-fluoro-12-(2-methoxyethyl)-3,9-dimethyl-3,6,9-triaza-1,12-diazoniabicyclo[12.4.0]octadeca-1(14),15,17-trien-6-yl]methyl]-3H-[1,3]oxazolo[3,4-a]pyridin-4-ium-1-one (PubChem CID 153347064) has the molecular formula C28H42FN6O3+3 and a molecular weight of 529.68 g/mol. Its IUPAC name is 5-[[18-ethenyl-12-fluoro-12-(2-methoxyethyl)-3,9-dimethyl-3,6,9-triaza-1,12-diazoniabicyclo[12.4.0]octadeca-1(14),15,17-trien-6-yl]methyl]-3H-[1,3]oxazolo[3,4-a]pyridin-4-ium-1-one.
| Compound Name | 5-[[18-ethenyl-12-fluoro-12-(2-methoxyethyl)-3,9-dimethyl-3,6,9-triaza-1,12-diazoniabicyclo[12.4.0]octadeca-1(14),15,17-trien-6-yl]methyl]-3H-[1,3]oxazolo[3,4-a]pyridin-4-ium-1-one |
|---|---|
| PubChem CID | 153347064 |
| Molecular Formula | C28H42FN6O3+3 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | 5-[[18-ethenyl-12-fluoro-12-(2-methoxyethyl)-3,9-dimethyl-3,6,9-triaza-1,12-diazoniabicyclo[12.4.0]octadeca-1(14),15,17-trien-6-yl]methyl]-3H-[1,3]oxazolo[3,4-a]pyridin-4-ium-1-one |
| SMILES | C=Cc1cccc2[n+]1CN(C)CCN(Cc1cccc3[n+]1COC3=O)CCN(C)CC[N+](F)(CCOC)C2 |
| InChI | InChI=1S/C28H42FN6O3/c1-5-24-8-6-10-26-21-35(29,18-19-37-4)17-16-30(2)12-14-32(15-13-31(3)22-33(24)26)20-25-9-7-11-27-28(36)38-23-34(25)27/h5-11H,1,12-23H2,2-4H3/q+3 |
| InChIKey | KCXMOUDWLMWUNI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 53.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|