C23H32N2O3 — CID 153348087
ethyl 2-[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]cyclohexylidene]acetate (PubChem CID 153348087) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is ethyl 2-[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]cyclohexylidene]acetate.
| Compound Name | ethyl 2-[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]cyclohexylidene]acetate |
|---|---|
| PubChem CID | 153348087 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | ethyl 2-[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]cyclohexylidene]acetate |
| SMILES | CCOC(=O)C=C1CCC(N[C@@H]2C[C@H](C)N(C(=O)CC)c3ccccc32)CC1 |
| InChI | InChI=1S/C23H32N2O3/c1-4-22(26)25-16(3)14-20(19-8-6-7-9-21(19)25)24-18-12-10-17(11-13-18)15-23(27)28-5-2/h6-9,15-16,18,20,24H,4-5,10-14H2,1-3H3/b17-15-/t16-,18?,20+/m0/s1 |
| InChIKey | CHIDYOSPPGFOOP-SMSQNQKLSA-N |
| XLogP | 4.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|