C22H34N2O3 — CID 153347882
methyl 8-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]octanoate (PubChem CID 153347882) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is methyl 8-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]octanoate.
| Compound Name | methyl 8-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]octanoate |
|---|---|
| PubChem CID | 153347882 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | methyl 8-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]octanoate |
| SMILES | CCC(=O)N1c2ccccc2[C@H](NCCCCCCCC(=O)OC)C[C@@H]1C |
| InChI | InChI=1S/C22H34N2O3/c1-4-21(25)24-17(2)16-19(18-12-9-10-13-20(18)24)23-15-11-7-5-6-8-14-22(26)27-3/h9-10,12-13,17,19,23H,4-8,11,14-16H2,1-3H3/t17-,19+/m0/s1 |
| InChIKey | KQSIAMHXJVHDMN-PKOBYXMFSA-N |
| XLogP | 4.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|