C28H42N2O2 — CID 153349242
3-(aminomethyl)-N-butyl-2-cyclohepta-2,4,6-trien-1-yloxy-5-[[(3Z,5Z)-octa-3,5-dienoxy]methyl]cyclohepta-2,4-dien-1-amine (PubChem CID 153349242) has the molecular formula C28H42N2O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 3-(aminomethyl)-N-butyl-2-cyclohepta-2,4,6-trien-1-yloxy-5-[[(3Z,5Z)-octa-3,5-dienoxy]methyl]cyclohepta-2,4-dien-1-amine.
| Compound Name | 3-(aminomethyl)-N-butyl-2-cyclohepta-2,4,6-trien-1-yloxy-5-[[(3Z,5Z)-octa-3,5-dienoxy]methyl]cyclohepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 153349242 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 3-(aminomethyl)-N-butyl-2-cyclohepta-2,4,6-trien-1-yloxy-5-[[(3Z,5Z)-octa-3,5-dienoxy]methyl]cyclohepta-2,4-dien-1-amine |
| SMILES | CC/C=C\C=C/CCOCC1=CC(CN)=C(OC2C=CC=CC=C2)C(NCCCC)CC1 |
| InChI | InChI=1S/C28H42N2O2/c1-3-5-7-8-11-14-20-31-23-24-17-18-27(30-19-6-4-2)28(25(21-24)22-29)32-26-15-12-9-10-13-16-26/h5,7-13,15-16,21,26-27,30H,3-4,6,14,17-20,22-23,29H2,1-2H3/b7-5-,11-8- |
| InChIKey | ACSLYJWSCUBWAC-HRTWQDJISA-N |
| XLogP | 5.67 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|