C24H41NO2 — CID 143435316
ethane;(2R)-2-[[4-[(Z,2E)-2-ethylidenehex-3-enoxy]cyclohepta-1,3,6-trien-1-yl]oxymethyl]pyrrolidine (PubChem CID 143435316) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is ethane;(2R)-2-[[4-[(Z,2E)-2-ethylidenehex-3-enoxy]cyclohepta-1,3,6-trien-1-yl]oxymethyl]pyrrolidine.
| Compound Name | ethane;(2R)-2-[[4-[(Z,2E)-2-ethylidenehex-3-enoxy]cyclohepta-1,3,6-trien-1-yl]oxymethyl]pyrrolidine |
|---|---|
| PubChem CID | 143435316 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | ethane;(2R)-2-[[4-[(Z,2E)-2-ethylidenehex-3-enoxy]cyclohepta-1,3,6-trien-1-yl]oxymethyl]pyrrolidine |
| SMILES | C/C=C(\C=C/CC)COC1=CC=C(OC[C@H]2CCCN2)C=CC1.CC.CC |
| InChI | InChI=1S/C20H29NO2.2C2H6/c1-3-5-8-17(4-2)15-22-19-10-6-11-20(13-12-19)23-16-18-9-7-14-21-18;2*1-2/h4-6,8,11-13,18,21H,3,7,9-10,14-16H2,1-2H3;2*1-2H3/b8-5-,17-4+;;/t18-;;/m1../s1 |
| InChIKey | BNEMGNKMGQGWCA-AEXAAIKXSA-N |
| XLogP | 6.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|