C12H21NO — CID 142125216
2-[[(2E,4Z)-hepta-2,4-dien-3-yl]oxymethyl]pyrrolidine (PubChem CID 142125216) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]oxymethyl]pyrrolidine.
| Compound Name | 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]oxymethyl]pyrrolidine |
|---|---|
| PubChem CID | 142125216 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]oxymethyl]pyrrolidine |
| SMILES | C/C=C(\C=C/CC)OCC1CCCN1 |
| InChI | InChI=1S/C12H21NO/c1-3-5-8-12(4-2)14-10-11-7-6-9-13-11/h4-5,8,11,13H,3,6-7,9-10H2,1-2H3/b8-5-,12-4+ |
| InChIKey | KLKOSFOYYABMDO-QJQXSPRCSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|