C23H36F3NO2 — CID 143435286
(2R)-2-[[(1E,3E,5Z)-1-[(E)-but-2-enoxy]hepta-1,3,5-trien-4-yl]oxymethyl]pyrrolidine;ethane;2-(trifluoromethyl)buta-1,3-diene (PubChem CID 143435286) has the molecular formula C23H36F3NO2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (2R)-2-[[(1E,3E,5Z)-1-[(E)-but-2-enoxy]hepta-1,3,5-trien-4-yl]oxymethyl]pyrrolidine;ethane;2-(trifluoromethyl)buta-1,3-diene.
| Compound Name | (2R)-2-[[(1E,3E,5Z)-1-[(E)-but-2-enoxy]hepta-1,3,5-trien-4-yl]oxymethyl]pyrrolidine;ethane;2-(trifluoromethyl)buta-1,3-diene |
|---|---|
| PubChem CID | 143435286 |
| Molecular Formula | C23H36F3NO2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | (2R)-2-[[(1E,3E,5Z)-1-[(E)-but-2-enoxy]hepta-1,3,5-trien-4-yl]oxymethyl]pyrrolidine;ethane;2-(trifluoromethyl)buta-1,3-diene |
| SMILES | C/C=C\C(=C/C=C/OC/C=C/C)OC[C@H]1CCCN1.C=CC(=C)C(F)(F)F.CC |
| InChI | InChI=1S/C16H25NO2.C5H5F3.C2H6/c1-3-5-12-18-13-7-10-16(8-4-2)19-14-15-9-6-11-17-15;1-3-4(2)5(6,7)8;1-2/h3-5,7-8,10,13,15,17H,6,9,11-12,14H2,1-2H3;3H,1-2H2;1-2H3/b5-3+,8-4-,13-7+,16-10+;;/t15-;;/m1../s1 |
| InChIKey | NNCVFEZVMXTPSH-XLABKJTPSA-N |
| XLogP | 6.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|