C20H29NO2 — CID 143435370
2-[[(2Z,5E)-5-[(2E,4Z)-hepta-2,4,6-trienoxy]octa-2,5,7-trienoxy]methyl]pyrrolidine (PubChem CID 143435370) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-[[(2Z,5E)-5-[(2E,4Z)-hepta-2,4,6-trienoxy]octa-2,5,7-trienoxy]methyl]pyrrolidine.
| Compound Name | 2-[[(2Z,5E)-5-[(2E,4Z)-hepta-2,4,6-trienoxy]octa-2,5,7-trienoxy]methyl]pyrrolidine |
|---|---|
| PubChem CID | 143435370 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-[[(2Z,5E)-5-[(2E,4Z)-hepta-2,4,6-trienoxy]octa-2,5,7-trienoxy]methyl]pyrrolidine |
| SMILES | C=C/C=C\C=C\CO/C(=C/C=C)C/C=C\COCC1CCCN1 |
| InChI | InChI=1S/C20H29NO2/c1-3-5-6-7-9-17-23-20(12-4-2)14-8-10-16-22-18-19-13-11-15-21-19/h3-10,12,19,21H,1-2,11,13-18H2/b6-5-,9-7+,10-8-,20-12+ |
| InChIKey | RMUVFBRFHCWWKX-IBBDNIEOSA-N |
| XLogP | 4.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|