C10H17NO — CID 143435395
(2R)-2-[[(3Z)-penta-1,3-dien-2-yl]oxymethyl]pyrrolidine (PubChem CID 143435395) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2R)-2-[[(3Z)-penta-1,3-dien-2-yl]oxymethyl]pyrrolidine.
| Compound Name | (2R)-2-[[(3Z)-penta-1,3-dien-2-yl]oxymethyl]pyrrolidine |
|---|---|
| PubChem CID | 143435395 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2R)-2-[[(3Z)-penta-1,3-dien-2-yl]oxymethyl]pyrrolidine |
| SMILES | C=C(/C=C\C)OC[C@H]1CCCN1 |
| InChI | InChI=1S/C10H17NO/c1-3-5-9(2)12-8-10-6-4-7-11-10/h3,5,10-11H,2,4,6-8H2,1H3/b5-3-/t10-/m1/s1 |
| InChIKey | IYXKLHRKCFZDRW-TZGMSPROSA-N |
| XLogP | 1.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|