C22H35NO2 — CID 143435369
ethane;2-[[(2Z,5E)-5-[(2E,4Z)-hepta-2,4,6-trienoxy]octa-2,5,7-trienoxy]methyl]pyrrolidine (PubChem CID 143435369) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is ethane;2-[[(2Z,5E)-5-[(2E,4Z)-hepta-2,4,6-trienoxy]octa-2,5,7-trienoxy]methyl]pyrrolidine.
| Compound Name | ethane;2-[[(2Z,5E)-5-[(2E,4Z)-hepta-2,4,6-trienoxy]octa-2,5,7-trienoxy]methyl]pyrrolidine |
|---|---|
| PubChem CID | 143435369 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | ethane;2-[[(2Z,5E)-5-[(2E,4Z)-hepta-2,4,6-trienoxy]octa-2,5,7-trienoxy]methyl]pyrrolidine |
| SMILES | C=C/C=C\C=C\CO/C(=C/C=C)C/C=C\COCC1CCCN1.CC |
| InChI | InChI=1S/C20H29NO2.C2H6/c1-3-5-6-7-9-17-23-20(12-4-2)14-8-10-16-22-18-19-13-11-15-21-19;1-2/h3-10,12,19,21H,1-2,11,13-18H2;1-2H3/b6-5-,9-7+,10-8-,20-12+; |
| InChIKey | MIOQJKPHUSMWDB-POSKAXIMSA-N |
| XLogP | 5.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|