C20H29NO2 — CID 143435317
(2R)-2-[[4-[(Z,2E)-2-ethylidenehex-3-enoxy]cyclohepta-1,3,6-trien-1-yl]oxymethyl]pyrrolidine (PubChem CID 143435317) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (2R)-2-[[4-[(Z,2E)-2-ethylidenehex-3-enoxy]cyclohepta-1,3,6-trien-1-yl]oxymethyl]pyrrolidine.
| Compound Name | (2R)-2-[[4-[(Z,2E)-2-ethylidenehex-3-enoxy]cyclohepta-1,3,6-trien-1-yl]oxymethyl]pyrrolidine |
|---|---|
| PubChem CID | 143435317 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (2R)-2-[[4-[(Z,2E)-2-ethylidenehex-3-enoxy]cyclohepta-1,3,6-trien-1-yl]oxymethyl]pyrrolidine |
| SMILES | C/C=C(\C=C/CC)COC1=CC=C(OC[C@H]2CCCN2)C=CC1 |
| InChI | InChI=1S/C20H29NO2/c1-3-5-8-17(4-2)15-22-19-10-6-11-20(13-12-19)23-16-18-9-7-14-21-18/h4-6,8,11-13,18,21H,3,7,9-10,14-16H2,1-2H3/b8-5-,17-4+/t18-/m1/s1 |
| InChIKey | NWOPPSNFEMRJLJ-KGNPGQCHSA-N |
| XLogP | 4.41 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|