C11H19NO — CID 142360194
1-methyl-2-[[(3Z)-penta-1,3-dien-2-yl]oxymethyl]pyrrolidine (PubChem CID 142360194) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-methyl-2-[[(3Z)-penta-1,3-dien-2-yl]oxymethyl]pyrrolidine.
| Compound Name | 1-methyl-2-[[(3Z)-penta-1,3-dien-2-yl]oxymethyl]pyrrolidine |
|---|---|
| PubChem CID | 142360194 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-methyl-2-[[(3Z)-penta-1,3-dien-2-yl]oxymethyl]pyrrolidine |
| SMILES | C=C(/C=C\C)OCC1CCCN1C |
| InChI | InChI=1S/C11H19NO/c1-4-6-10(2)13-9-11-7-5-8-12(11)3/h4,6,11H,2,5,7-9H2,1,3H3/b6-4- |
| InChIKey | GZPLSWVSUYILPP-XQRVVYSFSA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|