C23H52O8S — CID 153349276
1,3-bis(3-methoxypropoxy)-2,2-bis(3-methoxypropoxymethyl)propane;ethane;sulfane (PubChem CID 153349276) has the molecular formula C23H52O8S and a molecular weight of 488.73 g/mol. Its IUPAC name is 1,3-bis(3-methoxypropoxy)-2,2-bis(3-methoxypropoxymethyl)propane;ethane;sulfane.
| Compound Name | 1,3-bis(3-methoxypropoxy)-2,2-bis(3-methoxypropoxymethyl)propane;ethane;sulfane |
|---|---|
| PubChem CID | 153349276 |
| Molecular Formula | C23H52O8S |
| Molecular Weight | 488.73 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | 1,3-bis(3-methoxypropoxy)-2,2-bis(3-methoxypropoxymethyl)propane;ethane;sulfane |
| SMILES | CC.COCCCOCC(COCCCOC)(COCCCOC)COCCCOC.S |
| InChI | InChI=1S/C21H44O8.C2H6.H2S/c1-22-9-5-13-26-17-21(18-27-14-6-10-23-2,19-28-15-7-11-24-3)20-29-16-8-12-25-4;1-2;/h5-20H2,1-4H3;1-2H3;1H2 |
| InChIKey | BLDCYFMLZQEGBL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|