C24H50O8 — CID 156683117
1-methoxy-6-[3-(3-methoxypropoxy)-2,2-bis(3-methoxypropoxymethyl)propoxy]hexane (PubChem CID 156683117) has the molecular formula C24H50O8 and a molecular weight of 466.66 g/mol. Its IUPAC name is 1-methoxy-6-[3-(3-methoxypropoxy)-2,2-bis(3-methoxypropoxymethyl)propoxy]hexane.
| Compound Name | 1-methoxy-6-[3-(3-methoxypropoxy)-2,2-bis(3-methoxypropoxymethyl)propoxy]hexane |
|---|---|
| PubChem CID | 156683117 |
| Molecular Formula | C24H50O8 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | 1-methoxy-6-[3-(3-methoxypropoxy)-2,2-bis(3-methoxypropoxymethyl)propoxy]hexane |
| SMILES | COCCCCCCOCC(COCCCOC)(COCCCOC)COCCCOC |
| InChI | InChI=1S/C24H50O8/c1-25-12-7-5-6-8-16-29-20-24(21-30-17-9-13-26-2,22-31-18-10-14-27-3)23-32-19-11-15-28-4/h5-23H2,1-4H3 |
| InChIKey | RMFPLZISYYHKIL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|