About potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide
potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide (PubChem CID 153349366) has the molecular formula C9H18KN2O-
and a molecular weight of 209.35 g/mol. Its IUPAC name is potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide.
Molecular Properties
| Compound Name | potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide |
| PubChem CID | 153349366 |
| Molecular Formula | C9H18KN2O- |
| Molecular Weight | 209.35 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide |
| SMILES | CC(=O)NCC1CCC[N-]C1.[CH3-].[K+] |
| InChI | InChI=1S/C8H15N2O.CH3.K/c1-7(11)10-6-8-3-2-4-9-5-8;;/h8H,2-6H2,1H3,(H,10,11);1H3;/q2*-1;+1 |
| InChIKey | ITQXMMAUAKJXEU-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 43.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.35 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide?
The IUPAC name of potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide (CID 153349366) is potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide.
What is the SMILES notation for potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide?
The canonical SMILES for potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide is CC(=O)NCC1CCC[N-]C1.[CH3-].[K+].
What is the InChIKey of potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide?
The InChIKey is ITQXMMAUAKJXEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2O.CH3.K/c1-7(11)10-6-8-3-2-4-9-5-8;;/h8H,2-6H2,1H3,(H,10,11);1H3;/q2*-1;+1.
What are the key properties of potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide?
potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide has a molecular weight of 209.35 g/mol, XLogP of -1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;carbanide;N-(piperidin-1-id-3-ylmethyl)acetamide is sourced from PubChem (CID 153349366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).