C23H29NO4 — CID 153350458
tert-butyl N-[[3-[5-(hydroxymethyl)-1-benzofuran-7-yl]phenyl]methyl]carbamate;ethane (PubChem CID 153350458) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is tert-butyl N-[[3-[5-(hydroxymethyl)-1-benzofuran-7-yl]phenyl]methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[[3-[5-(hydroxymethyl)-1-benzofuran-7-yl]phenyl]methyl]carbamate;ethane |
|---|---|
| PubChem CID | 153350458 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | tert-butyl N-[[3-[5-(hydroxymethyl)-1-benzofuran-7-yl]phenyl]methyl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NCc1cccc(-c2cc(CO)cc3ccoc23)c1 |
| InChI | InChI=1S/C21H23NO4.C2H6/c1-21(2,3)26-20(24)22-12-14-5-4-6-16(9-14)18-11-15(13-23)10-17-7-8-25-19(17)18;1-2/h4-11,23H,12-13H2,1-3H3,(H,22,24);1-2H3 |
| InChIKey | JKZDLMCOJVCZRP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |