C13H16ClNO4S — CID 153354336
[1-(4-chloroanilino)-3-cyclopropyl-1-oxopropan-2-yl] methanesulfonate (PubChem CID 153354336) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is [1-(4-chloroanilino)-3-cyclopropyl-1-oxopropan-2-yl] methanesulfonate.
| Compound Name | [1-(4-chloroanilino)-3-cyclopropyl-1-oxopropan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 153354336 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [1-(4-chloroanilino)-3-cyclopropyl-1-oxopropan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC(CC1CC1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClNO4S/c1-20(17,18)19-12(8-9-2-3-9)13(16)15-11-6-4-10(14)5-7-11/h4-7,9,12H,2-3,8H2,1H3,(H,15,16) |
| InChIKey | RRFIGPGFSRGICC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|