C17H31NO2 — CID 153355270
N-[[4-(2,2-dimethylpropanoyl)cyclohexyl]methyl]-2-methylbut-2-enamide;molecular hydrogen (PubChem CID 153355270) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is N-[[4-(2,2-dimethylpropanoyl)cyclohexyl]methyl]-2-methylbut-2-enamide;molecular hydrogen.
| Compound Name | N-[[4-(2,2-dimethylpropanoyl)cyclohexyl]methyl]-2-methylbut-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 153355270 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | N-[[4-(2,2-dimethylpropanoyl)cyclohexyl]methyl]-2-methylbut-2-enamide;molecular hydrogen |
| SMILES | CC=C(C)C(=O)NCC1CCC(C(=O)C(C)(C)C)CC1.[H][H] |
| InChI | InChI=1S/C17H29NO2.H2/c1-6-12(2)16(20)18-11-13-7-9-14(10-8-13)15(19)17(3,4)5;/h6,13-14H,7-11H2,1-5H3,(H,18,20);1H |
| InChIKey | VAFDDHCGJDNTQU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|