C11H17N4NaO — CID 153355566
sodium;4,8-dimethyl-5,7-dihydro-2H-pteridin-2-id-6-one;propane (PubChem CID 153355566) has the molecular formula C11H17N4NaO and a molecular weight of 244.27 g/mol. Its IUPAC name is sodium;4,8-dimethyl-5,7-dihydro-2H-pteridin-2-id-6-one;propane.
| Compound Name | sodium;4,8-dimethyl-5,7-dihydro-2H-pteridin-2-id-6-one;propane |
|---|---|
| PubChem CID | 153355566 |
| Molecular Formula | C11H17N4NaO |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | sodium;4,8-dimethyl-5,7-dihydro-2H-pteridin-2-id-6-one;propane |
| SMILES | CCC.Cc1n[c-]nc2c1NC(=O)CN2C.[Na+] |
| InChI | InChI=1S/C8H9N4O.C3H8.Na/c1-5-7-8(10-4-9-5)12(2)3-6(13)11-7;1-3-2;/h3H2,1-2H3,(H,11,13);3H2,1-2H3;/q-1;;+1 |
| InChIKey | DYHDFGJKOKIEDD-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|