C28H24FN5O3 — CID 153357661
2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-1-(oxan-2-yl)pyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione (PubChem CID 153357661) has the molecular formula C28H24FN5O3 and a molecular weight of 497.53 g/mol. Its IUPAC name is 2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-1-(oxan-2-yl)pyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-1-(oxan-2-yl)pyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 153357661 |
| Molecular Formula | C28H24FN5O3 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 2-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-1-(oxan-2-yl)pyrazolo[3,4-b]pyridin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1nn(C2CCCCO2)c2nc(Nc3cccc4c3CCC4)c(F)cc12 |
| InChI | InChI=1S/C28H24FN5O3/c29-21-15-20-25(31-24(21)30-22-12-6-8-16-7-5-11-17(16)22)34(23-13-3-4-14-37-23)32-26(20)33-27(35)18-9-1-2-10-19(18)28(33)36/h1-2,6,8-10,12,15,23H,3-5,7,11,13-14H2,(H,30,31) |
| InChIKey | XPKSQAKWXPCTMT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|