C10H13F3N2O3 — CID 153358168
4-(2-propoxyethoxy)-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 153358168) has the molecular formula C10H13F3N2O3 and a molecular weight of 266.22 g/mol. Its IUPAC name is 4-(2-propoxyethoxy)-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-(2-propoxyethoxy)-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 153358168 |
| Molecular Formula | C10H13F3N2O3 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-(2-propoxyethoxy)-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | CCCOCCOc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O3/c1-2-3-17-4-5-18-7-6-14-15-9(16)8(7)10(11,12)13/h6H,2-5H2,1H3,(H,15,16) |
| InChIKey | NAAXJXFPEWQUIT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|