C10H11F3N2O4 — CID 170221556
3-[2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]ethoxy]propanal (PubChem CID 170221556) has the molecular formula C10H11F3N2O4 and a molecular weight of 280.20 g/mol. Its IUPAC name is 3-[2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]ethoxy]propanal.
| Compound Name | 3-[2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]ethoxy]propanal |
|---|---|
| PubChem CID | 170221556 |
| Molecular Formula | C10H11F3N2O4 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-[2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]ethoxy]propanal |
| SMILES | O=CCCOCCOc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O4/c11-10(12,13)8-7(6-14-15-9(8)17)19-5-4-18-3-1-2-16/h2,6H,1,3-5H2,(H,15,17) |
| InChIKey | PYMOXUUCEITTMD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|