C11H13F3N2O5 — CID 167173507
3-[(2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]propoxy]propanoic acid (PubChem CID 167173507) has the molecular formula C11H13F3N2O5 and a molecular weight of 310.23 g/mol. Its IUPAC name is 3-[(2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]propoxy]propanoic acid.
| Compound Name | 3-[(2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]propoxy]propanoic acid |
|---|---|
| PubChem CID | 167173507 |
| Molecular Formula | C11H13F3N2O5 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-[(2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]propoxy]propanoic acid |
| SMILES | C[C@H](COCCC(=O)O)Oc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O5/c1-6(5-20-3-2-8(17)18)21-7-4-15-16-10(19)9(7)11(12,13)14/h4,6H,2-3,5H2,1H3,(H,16,19)(H,17,18)/t6-/m1/s1 |
| InChIKey | MCMPTSLHMWBOPS-ZCFIWIBFSA-N |
| XLogP | 1.05 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|