C10H11F3N2O5 — CID 146218326
3-[2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]ethoxy]propanoic acid (PubChem CID 146218326) has the molecular formula C10H11F3N2O5 and a molecular weight of 296.20 g/mol. Its IUPAC name is 3-[2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 146218326 |
| Molecular Formula | C10H11F3N2O5 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-[2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O5/c11-10(12,13)8-6(5-14-15-9(8)18)20-4-3-19-2-1-7(16)17/h5H,1-4H2,(H,15,18)(H,16,17) |
| InChIKey | CFKRJERAHMMWFH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|