C20H24O4 — CID 153359580
methyl (4Z)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-4-ethenylhepta-4,6-dienoate (PubChem CID 153359580) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl (4Z)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-4-ethenylhepta-4,6-dienoate.
| Compound Name | methyl (4Z)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-4-ethenylhepta-4,6-dienoate |
|---|---|
| PubChem CID | 153359580 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | methyl (4Z)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-4-ethenylhepta-4,6-dienoate |
| SMILES | C=C/C=C(\C=C)CC(Oc1cccc2c1OC(C)(C)C2)C(=O)OC |
| InChI | InChI=1S/C20H24O4/c1-6-9-14(7-2)12-17(19(21)22-5)23-16-11-8-10-15-13-20(3,4)24-18(15)16/h6-11,17H,1-2,12-13H2,3-5H3/b14-9+ |
| InChIKey | HSOYNNUEKCAMEU-NTEUORMPSA-N |
| XLogP | 4.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|