C27H59BSSi6 — CID 15335978
[[3,5-bis[bis(trimethylsilyl)methyl]-2-sulfanylideneboranylphenyl]-trimethylsilylmethyl]-trimethylsilane (PubChem CID 15335978) has the molecular formula C27H59BSSi6 and a molecular weight of 595.16 g/mol. Its IUPAC name is [[3,5-bis[bis(trimethylsilyl)methyl]-2-sulfanylideneboranylphenyl]-trimethylsilylmethyl]-trimethylsilane.
| Compound Name | [[3,5-bis[bis(trimethylsilyl)methyl]-2-sulfanylideneboranylphenyl]-trimethylsilylmethyl]-trimethylsilane |
|---|---|
| PubChem CID | 15335978 |
| Molecular Formula | C27H59BSSi6 |
| Molecular Weight | 595.16 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | [[3,5-bis[bis(trimethylsilyl)methyl]-2-sulfanylideneboranylphenyl]-trimethylsilylmethyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(c1cc(C([Si](C)(C)C)[Si](C)(C)C)c(B=S)c(C([Si](C)(C)C)[Si](C)(C)C)c1)[Si](C)(C)C |
| InChI | InChI=1S/C27H59BSSi6/c1-30(2,3)25(31(4,5)6)21-19-22(26(32(7,8)9)33(10,11)12)24(28-29)23(20-21)27(34(13,14)15)35(16,17)18/h19-20,25-27H,1-18H3 |
| InChIKey | LOKFTMRDMQTLKD-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.16 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|