C21H20N2O2 — CID 153360087
5-methyl-7-[2-(1,2,3,4-tetrahydroisoquinolin-7-yl)ethynyl]-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 153360087) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-methyl-7-[2-(1,2,3,4-tetrahydroisoquinolin-7-yl)ethynyl]-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 5-methyl-7-[2-(1,2,3,4-tetrahydroisoquinolin-7-yl)ethynyl]-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 153360087 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 5-methyl-7-[2-(1,2,3,4-tetrahydroisoquinolin-7-yl)ethynyl]-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CN1C(=O)CCOc2ccc(C#Cc3ccc4c(c3)CNCC4)cc21 |
| InChI | InChI=1S/C21H20N2O2/c1-23-19-13-16(5-7-20(19)25-11-9-21(23)24)3-2-15-4-6-17-8-10-22-14-18(17)12-15/h4-7,12-13,22H,8-11,14H2,1H3 |
| InChIKey | SIEBSFDUUSBYOY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|