C12H13N — CID 70295509
7-prop-1-ynyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 70295509) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 7-prop-1-ynyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-prop-1-ynyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 70295509 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 7-prop-1-ynyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC#Cc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C12H13N/c1-2-3-10-4-5-11-6-7-13-9-12(11)8-10/h4-5,8,13H,6-7,9H2,1H3 |
| InChIKey | JKEVJPAQUAPSQI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|