C12H15Cl2F2N3 — CID 153360486
3,5-dichloro-4-(4,4-difluoropiperidin-1-yl)-1-N-methylbenzene-1,2-diamine (PubChem CID 153360486) has the molecular formula C12H15Cl2F2N3 and a molecular weight of 310.18 g/mol. Its IUPAC name is 3,5-dichloro-4-(4,4-difluoropiperidin-1-yl)-1-N-methylbenzene-1,2-diamine.
| Compound Name | 3,5-dichloro-4-(4,4-difluoropiperidin-1-yl)-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 153360486 |
| Molecular Formula | C12H15Cl2F2N3 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 3,5-dichloro-4-(4,4-difluoropiperidin-1-yl)-1-N-methylbenzene-1,2-diamine |
| SMILES | CNc1cc(Cl)c(N2CCC(F)(F)CC2)c(Cl)c1N |
| InChI | InChI=1S/C12H15Cl2F2N3/c1-18-8-6-7(13)11(9(14)10(8)17)19-4-2-12(15,16)3-5-19/h6,18H,2-5,17H2,1H3 |
| InChIKey | HSWMRXOUTQPUHF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|