C22H27NO4 — CID 153360813
ethane;methyl 2-methoxy-4-(1-propanoyl-2,3-dihydroindol-5-yl)benzoate (PubChem CID 153360813) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is ethane;methyl 2-methoxy-4-(1-propanoyl-2,3-dihydroindol-5-yl)benzoate.
| Compound Name | ethane;methyl 2-methoxy-4-(1-propanoyl-2,3-dihydroindol-5-yl)benzoate |
|---|---|
| PubChem CID | 153360813 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | ethane;methyl 2-methoxy-4-(1-propanoyl-2,3-dihydroindol-5-yl)benzoate |
| SMILES | CC.CCC(=O)N1CCc2cc(-c3ccc(C(=O)OC)c(OC)c3)ccc21 |
| InChI | InChI=1S/C20H21NO4.C2H6/c1-4-19(22)21-10-9-15-11-13(6-8-17(15)21)14-5-7-16(20(23)25-3)18(12-14)24-2;1-2/h5-8,11-12H,4,9-10H2,1-3H3;1-2H3 |
| InChIKey | JGCOHNZDGBRNJN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |