C19H17NO3 — CID 156653578
2-methoxy-4-(1-prop-1-ynyl-2,3-dihydroindol-5-yl)benzoic acid (PubChem CID 156653578) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-methoxy-4-(1-prop-1-ynyl-2,3-dihydroindol-5-yl)benzoic acid.
| Compound Name | 2-methoxy-4-(1-prop-1-ynyl-2,3-dihydroindol-5-yl)benzoic acid |
|---|---|
| PubChem CID | 156653578 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-methoxy-4-(1-prop-1-ynyl-2,3-dihydroindol-5-yl)benzoic acid |
| SMILES | CC#CN1CCc2cc(-c3ccc(C(=O)O)c(OC)c3)ccc21 |
| InChI | InChI=1S/C19H17NO3/c1-3-9-20-10-8-15-11-13(5-7-17(15)20)14-4-6-16(19(21)22)18(12-14)23-2/h4-7,11-12H,8,10H2,1-2H3,(H,21,22) |
| InChIKey | LKIRUZVPIPBTAL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|