C8H15FN2 — CID 153364260
(Z)-2-[(E)-fluoromethyliminomethyl]-3-methylpent-1-en-1-amine (PubChem CID 153364260) has the molecular formula C8H15FN2 and a molecular weight of 158.22 g/mol. Its IUPAC name is (Z)-2-[(E)-fluoromethyliminomethyl]-3-methylpent-1-en-1-amine.
| Compound Name | (Z)-2-[(E)-fluoromethyliminomethyl]-3-methylpent-1-en-1-amine |
|---|---|
| PubChem CID | 153364260 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | (Z)-2-[(E)-fluoromethyliminomethyl]-3-methylpent-1-en-1-amine |
| SMILES | CCC(C)C(=C/N)/C=N/CF |
| InChI | InChI=1S/C8H15FN2/c1-3-7(2)8(4-10)5-11-6-9/h4-5,7H,3,6,10H2,1-2H3/b8-4+,11-5+ |
| InChIKey | NGDHFIIXBGQPNY-JNKBEKGTSA-N |
| XLogP | 1.87 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|