C9H15F3N2 — CID 156898616
(Z)-4-methyl-2-(2,2,2-trifluoroethyliminomethyl)pent-1-en-1-amine (PubChem CID 156898616) has the molecular formula C9H15F3N2 and a molecular weight of 208.23 g/mol. Its IUPAC name is (Z)-4-methyl-2-(2,2,2-trifluoroethyliminomethyl)pent-1-en-1-amine.
| Compound Name | (Z)-4-methyl-2-(2,2,2-trifluoroethyliminomethyl)pent-1-en-1-amine |
|---|---|
| PubChem CID | 156898616 |
| Molecular Formula | C9H15F3N2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (Z)-4-methyl-2-(2,2,2-trifluoroethyliminomethyl)pent-1-en-1-amine |
| SMILES | CC(C)CC(=C/N)/C=N/CC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2/c1-7(2)3-8(4-13)5-14-6-9(10,11)12/h4-5,7H,3,6,13H2,1-2H3/b8-4-,14-5+ |
| InChIKey | SQLITSXQBKYKIB-NYQUBNGWSA-N |
| XLogP | 2.51 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|