C9H21N3O — CID 153364428
3-[[(Z)-4-aminobut-3-en-2-ylidene]amino]propanamide;ethane;molecular hydrogen (PubChem CID 153364428) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-[[(Z)-4-aminobut-3-en-2-ylidene]amino]propanamide;ethane;molecular hydrogen.
| Compound Name | 3-[[(Z)-4-aminobut-3-en-2-ylidene]amino]propanamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 153364428 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-[[(Z)-4-aminobut-3-en-2-ylidene]amino]propanamide;ethane;molecular hydrogen |
| SMILES | CC.CC(/C=C\N)=N\CCC(N)=O.[H][H] |
| InChI | InChI=1S/C7H13N3O.C2H6.H2/c1-6(2-4-8)10-5-3-7(9)11;1-2;/h2,4H,3,5,8H2,1H3,(H2,9,11);1-2H3;1H/b4-2-,10-6+;; |
| InChIKey | OOGYVNNWPFEART-GDDJLYHMSA-N |
| XLogP | 1.07 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|