C10H19N3O — CID 174114278
4-amino-2-butan-2-ylimino-N,N-dimethylbut-3-enamide (PubChem CID 174114278) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-amino-2-butan-2-ylimino-N,N-dimethylbut-3-enamide.
| Compound Name | 4-amino-2-butan-2-ylimino-N,N-dimethylbut-3-enamide |
|---|---|
| PubChem CID | 174114278 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 4-amino-2-butan-2-ylimino-N,N-dimethylbut-3-enamide |
| SMILES | CCC(C)/N=C(\C=CN)C(=O)N(C)C |
| InChI | InChI=1S/C10H19N3O/c1-5-8(2)12-9(6-7-11)10(14)13(3)4/h6-8H,5,11H2,1-4H3/b7-6?,12-9+ |
| InChIKey | DTHJHMVHQHIMEP-VVQZTGQSSA-N |
| XLogP | 0.79 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|