C18H22N6O — CID 153364723
(4R)-3-amino-2-imino-1,4,6-trimethyl-N-(1-methylisoquinolin-6-yl)-4H-pyrimidine-5-carboxamide (PubChem CID 153364723) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is (4R)-3-amino-2-imino-1,4,6-trimethyl-N-(1-methylisoquinolin-6-yl)-4H-pyrimidine-5-carboxamide.
| Compound Name | (4R)-3-amino-2-imino-1,4,6-trimethyl-N-(1-methylisoquinolin-6-yl)-4H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 153364723 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (4R)-3-amino-2-imino-1,4,6-trimethyl-N-(1-methylisoquinolin-6-yl)-4H-pyrimidine-5-carboxamide |
| SMILES | [H]/N=C1\N(C)C(C)=C(C(=O)Nc2ccc3c(C)nccc3c2)[C@@H](C)N1N |
| InChI | InChI=1S/C18H22N6O/c1-10-15-6-5-14(9-13(15)7-8-21-10)22-17(25)16-11(2)23(4)18(19)24(20)12(16)3/h5-9,12,19H,20H2,1-4H3,(H,22,25)/b19-18+/t12-/m1/s1 |
| InChIKey | SKDKLBIULIOSJN-ROHOOWMXSA-N |
| XLogP | 2.20 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|