C33H47ClNO5+ — CID 153366649
[(1E,4Z,6Z)-1-[3-chloro-4-[(Z)-(3,7-dimethyl-2-bicyclo[3.3.1]nonanylidene)-methoxymethyl]-2-hydroxyphenyl]-7-hexoxyhepta-1,4,6-trien-3-ylidene]azanium;formic acid (PubChem CID 153366649) has the molecular formula C33H47ClNO5+ and a molecular weight of 573.19 g/mol. Its IUPAC name is [(1E,4Z,6Z)-1-[3-chloro-4-[(Z)-(3,7-dimethyl-2-bicyclo[3.3.1]nonanylidene)-methoxymethyl]-2-hydroxyphenyl]-7-hexoxyhepta-1,4,6-trien-3-ylidene]azanium;formic acid.
| Compound Name | [(1E,4Z,6Z)-1-[3-chloro-4-[(Z)-(3,7-dimethyl-2-bicyclo[3.3.1]nonanylidene)-methoxymethyl]-2-hydroxyphenyl]-7-hexoxyhepta-1,4,6-trien-3-ylidene]azanium;formic acid |
|---|---|
| PubChem CID | 153366649 |
| Molecular Formula | C33H47ClNO5+ |
| Molecular Weight | 573.19 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | [(1E,4Z,6Z)-1-[3-chloro-4-[(Z)-(3,7-dimethyl-2-bicyclo[3.3.1]nonanylidene)-methoxymethyl]-2-hydroxyphenyl]-7-hexoxyhepta-1,4,6-trien-3-ylidene]azanium;formic acid |
| SMILES | CCCCCCO/C=C\C=C/C(=[NH2+])/C=C/c1ccc(/C(OC)=C2\C(C)CC3CC(C)CC2C3)c(Cl)c1O.O=CO |
| InChI | InChI=1S/C32H44ClNO3.CH2O2/c1-5-6-7-9-16-37-17-10-8-11-27(34)14-12-25-13-15-28(30(33)31(25)35)32(36-4)29-23(3)20-24-18-22(2)19-26(29)21-24;2-1-3/h8,10-15,17,22-24,26,34-35H,5-7,9,16,18-21H2,1-4H3;1H,(H,2,3)/p+1/b11-8-,14-12+,17-10-,32-29-,34-27?; |
| InChIKey | SIVRSRJMXXIOHF-QKCWLMRFSA-O |
| XLogP | 7.08 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.19 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|