C35H43F2N3O5S — CID 153366696
ethyl 3-[3-amino-5-methoxy-4-(methylamino)phenyl]-3-[1-[(4S)-8-(1,1-difluoroethyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoate (PubChem CID 153366696) has the molecular formula C35H43F2N3O5S and a molecular weight of 655.81 g/mol. Its IUPAC name is ethyl 3-[3-amino-5-methoxy-4-(methylamino)phenyl]-3-[1-[(4S)-8-(1,1-difluoroethyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoate.
| Compound Name | ethyl 3-[3-amino-5-methoxy-4-(methylamino)phenyl]-3-[1-[(4S)-8-(1,1-difluoroethyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoate |
|---|---|
| PubChem CID | 153366696 |
| Molecular Formula | C35H43F2N3O5S |
| Molecular Weight | 655.81 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | ethyl 3-[3-amino-5-methoxy-4-(methylamino)phenyl]-3-[1-[(4S)-8-(1,1-difluoroethyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoate |
| SMILES | CCOC(=O)CC(c1cc(N)c(NC)c(OC)c1)c1ccc(C)c2c1CCC2N1C[C@@H](C)Cc2ccc(C(C)(F)F)cc2S1(=O)=O |
| InChI | InChI=1S/C35H43F2N3O5S/c1-7-45-32(41)18-27(23-15-28(38)34(39-5)30(16-23)44-6)25-11-8-21(3)33-26(25)12-13-29(33)40-19-20(2)14-22-9-10-24(35(4,36)37)17-31(22)46(40,42)43/h8-11,15-17,20,27,29,39H,7,12-14,18-19,38H2,1-6H3/t20-,27?,29?/m0/s1 |
| InChIKey | ONRVHWGFGMOOHW-MSYBNWNISA-N |
| XLogP | 6.69 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.81 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|