C18H17F4N5O2 — CID 153366895
[(4S)-3,3-difluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]methanone (PubChem CID 153366895) has the molecular formula C18H17F4N5O2 and a molecular weight of 411.36 g/mol. Its IUPAC name is [(4S)-3,3-difluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]methanone.
| Compound Name | [(4S)-3,3-difluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]methanone |
|---|---|
| PubChem CID | 153366895 |
| Molecular Formula | C18H17F4N5O2 |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [(4S)-3,3-difluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]methanone |
| SMILES | Cc1nnc(N2CC[C@@H](C(=O)N3N=CC[C@H]3c3cc(F)cc(F)c3)C(F)(F)C2)o1 |
| InChI | InChI=1S/C18H17F4N5O2/c1-10-24-25-17(29-10)26-5-3-14(18(21,22)9-26)16(28)27-15(2-4-23-27)11-6-12(19)8-13(20)7-11/h4,6-8,14-15H,2-3,5,9H2,1H3/t14-,15-/m0/s1 |
| InChIKey | BLWOEAIZHBGXMR-GJZGRUSLSA-N |
| XLogP | 3.08 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |