C19H21F2N5O2 — CID 153366951
[(3R)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[(2S,4S)-2-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]methanone (PubChem CID 153366951) has the molecular formula C19H21F2N5O2 and a molecular weight of 389.41 g/mol. Its IUPAC name is [(3R)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[(2S,4S)-2-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]methanone.
| Compound Name | [(3R)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[(2S,4S)-2-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 153366951 |
| Molecular Formula | C19H21F2N5O2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [(3R)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[(2S,4S)-2-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]methanone |
| SMILES | Cc1nnc(N2CC[C@H](C(=O)N3N=CC[C@@H]3c3cc(F)cc(F)c3)C[C@@H]2C)o1 |
| InChI | InChI=1S/C19H21F2N5O2/c1-11-7-13(4-6-25(11)19-24-23-12(2)28-19)18(27)26-17(3-5-22-26)14-8-15(20)10-16(21)9-14/h5,8-11,13,17H,3-4,6-7H2,1-2H3/t11-,13-,17+/m0/s1 |
| InChIKey | SBVVTIBAPNYJBI-PLQHRBFRSA-N |
| XLogP | 3.22 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |