C26H27N3O2 — CID 153367729
molecular hydrogen;N-[1-oxo-4-phenyl-1-(quinolin-5-ylamino)butan-2-yl]benzamide (PubChem CID 153367729) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is molecular hydrogen;N-[1-oxo-4-phenyl-1-(quinolin-5-ylamino)butan-2-yl]benzamide.
| Compound Name | molecular hydrogen;N-[1-oxo-4-phenyl-1-(quinolin-5-ylamino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 153367729 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | molecular hydrogen;N-[1-oxo-4-phenyl-1-(quinolin-5-ylamino)butan-2-yl]benzamide |
| SMILES | O=C(NC(CCc1ccccc1)C(=O)Nc1cccc2ncccc12)c1ccccc1.[H][H].[H][H] |
| InChI | InChI=1S/C26H23N3O2.2H2/c30-25(20-11-5-2-6-12-20)29-24(17-16-19-9-3-1-4-10-19)26(31)28-23-15-7-14-22-21(23)13-8-18-27-22;;/h1-15,18,24H,16-17H2,(H,28,31)(H,29,30);2*1H |
| InChIKey | MIMFTSPNPZRERR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |