C26H32N2O3 — CID 144901089
N-[1-(3-methoxy-2-methylanilino)-1-oxo-5-phenylpentan-2-yl]benzamide;molecular hydrogen (PubChem CID 144901089) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-[1-(3-methoxy-2-methylanilino)-1-oxo-5-phenylpentan-2-yl]benzamide;molecular hydrogen.
| Compound Name | N-[1-(3-methoxy-2-methylanilino)-1-oxo-5-phenylpentan-2-yl]benzamide;molecular hydrogen |
|---|---|
| PubChem CID | 144901089 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-[1-(3-methoxy-2-methylanilino)-1-oxo-5-phenylpentan-2-yl]benzamide;molecular hydrogen |
| SMILES | COc1cccc(NC(=O)C(CCCc2ccccc2)NC(=O)c2ccccc2)c1C.[H][H].[H][H] |
| InChI | InChI=1S/C26H28N2O3.2H2/c1-19-22(16-10-18-24(19)31-2)27-26(30)23(17-9-13-20-11-5-3-6-12-20)28-25(29)21-14-7-4-8-15-21;;/h3-8,10-12,14-16,18,23H,9,13,17H2,1-2H3,(H,27,30)(H,28,29);2*1H |
| InChIKey | ARNMLDNTZBONKU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |