C42H39NO2 — CID 153369970
(2Z,4Z)-5-[(4-hydroxy-3,5-diphenylcyclohex-2-en-1-yl)amino]-3-(6-methylcyclohexa-2,4-dien-1-yl)-1,5-diphenylpenta-2,4-dien-1-one (PubChem CID 153369970) has the molecular formula C42H39NO2 and a molecular weight of 589.78 g/mol. Its IUPAC name is (2Z,4Z)-5-[(4-hydroxy-3,5-diphenylcyclohex-2-en-1-yl)amino]-3-(6-methylcyclohexa-2,4-dien-1-yl)-1,5-diphenylpenta-2,4-dien-1-one.
| Compound Name | (2Z,4Z)-5-[(4-hydroxy-3,5-diphenylcyclohex-2-en-1-yl)amino]-3-(6-methylcyclohexa-2,4-dien-1-yl)-1,5-diphenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 153369970 |
| Molecular Formula | C42H39NO2 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | (2Z,4Z)-5-[(4-hydroxy-3,5-diphenylcyclohex-2-en-1-yl)amino]-3-(6-methylcyclohexa-2,4-dien-1-yl)-1,5-diphenylpenta-2,4-dien-1-one |
| SMILES | CC1C=CC=CC1C(/C=C(\NC1C=C(c2ccccc2)C(O)C(c2ccccc2)C1)c1ccccc1)=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C42H39NO2/c1-30-16-14-15-25-37(30)35(27-41(44)34-23-12-5-13-24-34)26-40(33-21-10-4-11-22-33)43-36-28-38(31-17-6-2-7-18-31)42(45)39(29-36)32-19-8-3-9-20-32/h2-28,30,36-37,39,42-43,45H,29H2,1H3/b35-27+,40-26- |
| InChIKey | CGDFYLNIJNRBJT-BNOFKJKTSA-N |
| XLogP | 8.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|