C59H112N2O5 — CID 153370641
1-O-[(E)-2-butyloct-5-enyl] 19-O-(2-butyloctyl) (10R)-10-[nonanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate (PubChem CID 153370641) has the molecular formula C59H112N2O5 and a molecular weight of 929.55 g/mol. Its IUPAC name is 1-O-[(E)-2-butyloct-5-enyl] 19-O-(2-butyloctyl) (10R)-10-[nonanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate.
| Compound Name | 1-O-[(E)-2-butyloct-5-enyl] 19-O-(2-butyloctyl) (10R)-10-[nonanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate |
|---|---|
| PubChem CID | 153370641 |
| Molecular Formula | C59H112N2O5 |
| Molecular Weight | 929.55 g/mol |
| Exact Mass | 928.86 |
| IUPAC Name | 1-O-[(E)-2-butyloct-5-enyl] 19-O-(2-butyloctyl) (10R)-10-[nonanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate |
| SMILES | CC/C=C/CCC(CCCC)COC(=O)CCCCCCCC[C@@H](CCCCCCCCC(=O)OCC(CCCC)CCCCCC)N(CCCN1CCCC1)C(=O)CCCCCCCC |
| InChI | InChI=1S/C59H112N2O5/c1-6-11-16-19-26-33-45-57(62)61(51-38-50-60-48-36-37-49-60)56(43-31-24-20-22-27-34-46-58(63)65-52-54(39-14-9-4)41-29-17-12-7-2)44-32-25-21-23-28-35-47-59(64)66-53-55(40-15-10-5)42-30-18-13-8-3/h12,17,54-56H,6-11,13-16,18-53H2,1-5H3/b17-12+/t54?,55?,56-/m0/s1 |
| InChIKey | QKNGXLNXJAHNAT-RXQHLRGISA-N |
| XLogP | 17.08 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.55 |
| LogP ≤ 5 | 17.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|