C22H37NO4 — CID 22770558
ethyl 6-methyl-7-[2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]heptanoate (PubChem CID 22770558) has the molecular formula C22H37NO4 and a molecular weight of 379.54 g/mol. Its IUPAC name is ethyl 6-methyl-7-[2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]heptanoate.
| Compound Name | ethyl 6-methyl-7-[2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 22770558 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | ethyl 6-methyl-7-[2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]heptanoate |
| SMILES | CCCCCC(=O)/C=C/C1CCC(=O)N1CC(C)CCCCC(=O)OCC |
| InChI | InChI=1S/C22H37NO4/c1-4-6-7-11-20(24)15-13-19-14-16-21(25)23(19)17-18(3)10-8-9-12-22(26)27-5-2/h13,15,18-19H,4-12,14,16-17H2,1-3H3/b15-13+ |
| InChIKey | JHSRTTSMSUNSBO-FYWRMAATSA-N |
| XLogP | 4.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|