C21H31FN4O2 — CID 153372011
tert-butyl 3-fluoro-4-[(4-methyl-1,2,3,4,6,10b-hexahydropyrazino[2,1-a]isoindol-8-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 153372011) has the molecular formula C21H31FN4O2 and a molecular weight of 390.50 g/mol. Its IUPAC name is tert-butyl 3-fluoro-4-[(4-methyl-1,2,3,4,6,10b-hexahydropyrazino[2,1-a]isoindol-8-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-4-[(4-methyl-1,2,3,4,6,10b-hexahydropyrazino[2,1-a]isoindol-8-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 153372011 |
| Molecular Formula | C21H31FN4O2 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | tert-butyl 3-fluoro-4-[(4-methyl-1,2,3,4,6,10b-hexahydropyrazino[2,1-a]isoindol-8-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC1CNCC2c3ccc(NC4CN(C(=O)OC(C)(C)C)CC4F)cc3CN12 |
| InChI | InChI=1S/C21H31FN4O2/c1-13-8-23-9-19-16-6-5-15(7-14(16)10-26(13)19)24-18-12-25(11-17(18)22)20(27)28-21(2,3)4/h5-7,13,17-19,23-24H,8-12H2,1-4H3 |
| InChIKey | KFUYMPLKPGHUMQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |