About potassium;cycloheptane;propane
potassium;cycloheptane;propane (PubChem CID 153372056) has the molecular formula C10H20K-
and a molecular weight of 179.37 g/mol. Its IUPAC name is potassium;cycloheptane;propane.
Molecular Properties
| Compound Name | potassium;cycloheptane;propane |
| PubChem CID | 153372056 |
| Molecular Formula | C10H20K- |
| Molecular Weight | 179.37 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | potassium;cycloheptane;propane |
| SMILES | C1CCCCCC1.[CH2-]C[CH2-].[K+] |
| InChI | InChI=1S/C7H14.C3H6.K/c1-2-4-6-7-5-3-1;1-3-2;/h1-7H2;1-3H2;/q;-2;+1 |
| InChIKey | ZTQULYXBQAIBPM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;cycloheptane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;cycloheptane;propane?
The IUPAC name of potassium;cycloheptane;propane (CID 153372056) is potassium;cycloheptane;propane.
What is the SMILES notation for potassium;cycloheptane;propane?
The canonical SMILES for potassium;cycloheptane;propane is C1CCCCCC1.[CH2-]C[CH2-].[K+].
What is the InChIKey of potassium;cycloheptane;propane?
The InChIKey is ZTQULYXBQAIBPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C3H6.K/c1-2-4-6-7-5-3-1;1-3-2;/h1-7H2;1-3H2;/q;-2;+1.
What are the key properties of potassium;cycloheptane;propane?
potassium;cycloheptane;propane has a molecular weight of 179.37 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;cycloheptane;propane is sourced from PubChem (CID 153372056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).