C12H16N2O6 — CID 153373419
3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione (PubChem CID 153373419) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione.
| Compound Name | 3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 153373419 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione |
| SMILES | CON1C(=O)CCC1=O.O=CCCN1C(=O)C=CC1O |
| InChI | InChI=1S/C7H9NO3.C5H7NO3/c9-5-1-4-8-6(10)2-3-7(8)11;1-9-6-4(7)2-3-5(6)8/h2-3,5-6,10H,1,4H2;2-3H2,1H3 |
| InChIKey | WIYRNONNVGOZBG-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|